Boronic acid derivatives
Chemscene ChemScene | 3-Aminophenylboronic acid | 25G | CS-W018320 | 0.98 | 30418-59-8| MFCD00007755 | 136.94
ChemScene | 3-Aminophenylboronic acid | 25G | CS-W018320 | 0.98 | 30418-59-8| MFCD00007755 | 136.94
Chemscene ChemScene | (4-Chloro-3-cyanophenyl)boronic acid | 5G | CS-W008298 | 0.98 | 871332-95-5| MFCD08056360 | 181.39
ChemScene | (4-Chloro-3-cyanophenyl)boronic acid | 5G | CS-W008298 | 0.98 | 871332-95-5| MFCD08056360 | 181.39
Chemscene ChemScene | (2-Fluoro-5-(trifluoromethoxy)phenyl)boronic acid | 10G | CS-W014228 | 0.97 | 881402-22-8| MFCD09027234 | 223.92
ChemScene | (2-Fluoro-5-(trifluoromethoxy)phenyl)boronic acid | 10G | CS-W014228 | 0.97 | 881402-22-8| MFCD09027234 | 223.92
Chemscene ChemScene | 5-Quinolinylboronic acid | 5G | CS-W003017 | 0.98 | 355386-94-6| MFCD03095058 | 172.98
ChemScene | 5-Quinolinylboronic acid | 5G | CS-W003017 | 0.98 | 355386-94-6| MFCD03095058 | 172.98
Chemscene ChemScene | 2,3-Dihydrobenzofuran-5-boronic acid | 5G | CS-W016099 | 0.98 | 227305-69-3| MFCD02681979 | 163.97
ChemScene | 2,3-Dihydrobenzofuran-5-boronic acid | 5G | CS-W016099 | 0.98 | 227305-69-3| MFCD02681979 | 163.97
eMolecules 88675-31-4 | 2-Bromo-1-(4-fluorophenyl)-2-phenylethanone | MFCD00699290 | 250mg
Ambeed | 2-Bromo-1-(4-fluorophenyl)-2-phenylethanone | 250mg | 525216648 | A479470 | 88675-31-4 | MFCD00699290 | 293.135 | C14H10BrFO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 170230-88-3 | 5-Carboxy-2-methylphenylboronic acid | Combi-Blocks | MFCD08061639 | 179.970 | C8H9BO4 | 95.000 | Cc1ccc(cc1B(O)O)C(O)=O | 1g | 117529518
5-Carboxy-2-methylphenylboronic acid | Combi-Blocks | 170230-88-3 | MFCD08061639 | 179.970 | C8H9BO4 | 95.000 | Cc1ccc(cc1B(O)O)C(O)=O | 1g | 117529518
eMolecules 167773-06-0 | 2-Buten-2-ylboronic acid pinacol ester | J & W PharmLab LLC182.070 | C10H19BO2 | 96.000 | CC=C(C)B1OC(C)(C)C(C)(C)O1 | 5g | 289351782
2-Buten-2-ylboronic acid pinacol ester | J & W PharmLab LLC | 167773-06-0182.070 | C10H19BO2 | 96.000 | CC=C(C)B1OC(C)(C)C(C)(C)O1 | 5g | 289351782
eMolecules 1780221-18-2 | 1-Amino-1-(4-fluorophenyl)-2-methylpropan-2-ol | 250mg
Ambeed | 2266-Tetramethylpiperidin-4-yl benzoate | 5g | 788438795 | A119995 | 26275-88-7 | MFCD00429766 | 261.365 | C16H23NO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Chembridge Corporation (2,6-DIMETHOXYPHENYL)BORONIC A
(2,6-dimethoxyphenyl)boronic acid; CAS: 23112-96-1
=O)C#N | 1g | 117522031](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502186481.JPG-250.jpg)
eMolecules 913835-33-3 | 3-Cyano-5-nitrophenylboronic acid | Combi-Blocks | MFCD03411554 | 191.940 | C7H5BN2O4 | 98.000 | OB(O)c1cc(cc(c1)[N+]([O-])=O)C#N | 1g | 117522031
3-Cyano-5-nitrophenylboronic acid | Combi-Blocks | 913835-33-3 | MFCD03411554 | 191.940 | C7H5BN2O4 | 98.000 | OB(O)c1cc(cc(c1)[N+]([O-])=O)C#N | 1g | 117522031
Chemscene ChemScene | (2-Chloro-4-cyanophenyl)boronic acid | 250MG | CS-0167267 | 0.98 | 677743-50-9| MFCD18392511 | 181.39
ChemScene | (2-Chloro-4-cyanophenyl)boronic acid | 250MG | CS-0167267 | 0.98 | 677743-50-9| MFCD18392511 | 181.39
eMolecules 1082366-52-6 | Ambeed | (4-((4-Acetylpiperazin-1-yl)methyl)phenyl)boronic acid | 250mg | 721418521 | A1664921 | 262.12 | C13H19BN2O3
Ambeed | N-Benzyl-1-(2-(4455-tetramethyl-132-dioxaborolan-2-yl)phenyl)methanamine | 100mg | 714084758 | A220233 | 1150271-53-6 | MFCD09998360 | 323.240 | C20H26BNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Cayman Chemical 19 RHETE Fatty Acids and Deriv
A potent vasodilator of renal arterioles; 30% of the metabolite composition of arachidonic acid by CYP2E1; potent vasodilator of renal preglomerular vessels; blocks 20-HETE-induced vasoconstriction of renal arterioles at 1 µM
eMolecules 1621605-71-7 | (3-AMINO-2-FLUOROPHENYL)BORONIC ACID | AstaTech | MFCD20726103 | 154.940 | C6H7BFNO2 | 95.000 | Nc1cccc(B(O)O)c1F | 0.1g | 696740378
(3-AMINO-2-FLUOROPHENYL)BORONIC ACID | AstaTech | 1621605-71-7 | MFCD20726103 | 154.940 | C6H7BFNO2 | 95.000 | Nc1cccc(B(O)O)c1F | 0.1g | 696740378